CAS 1375473-56-5 is the registry number for 4-Amino-2-bromo-5-nitrobenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-amino-2-bromo-5-nitrobenzenesulfonamide (CAS 1375473-56-5) is a chemical compound with the molecular formula C6H6BrN3O4S and a molecular weight of 296.10 g/mol. IUPAC name: 4-amino-2-bromo-5-nitrobenzenesulfonamide. InChIKey: XDUZLYUBCCHEQD-UHFFFAOYSA-N.
| Molecular formula | C6H6BrN3O4S |
|---|---|
| Molecular weight | 296.10 g/mol |
| IUPAC name | 4-amino-2-bromo-5-nitrobenzenesulfonamide |
| InChIKey | XDUZLYUBCCHEQD-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)S(=O)(=O)N)[N+](=O)[O-])N |
Computed by PubChem (NCBI)