CAS 1375473-68-9 is the registry number for 5-Bromo-N-(1,2,3,4-tetrahydroquinolin-6-yl)thiophene-2-carboxamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-bromo-N-(1,2,3,4-tetrahydroquinolin-6-yl)thiophene-2-carboxamide (CAS 1375473-68-9) is a chemical compound with the molecular formula C14H13BrN2OS and a molecular weight of 337.24 g/mol. IUPAC name: 5-bromo-N-(1,2,3,4-tetrahydroquinolin-6-yl)thiophene-2-carboxamide. InChIKey: FHBRCFYLWUIGMG-UHFFFAOYSA-N.
| Molecular formula | C14H13BrN2OS |
|---|---|
| Molecular weight | 337.24 g/mol |
| IUPAC name | 5-bromo-N-(1,2,3,4-tetrahydroquinolin-6-yl)thiophene-2-carboxamide |
| InChIKey | FHBRCFYLWUIGMG-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)NC(=O)C3=CC=C(S3)Br)NC1 |
Computed by PubChem (NCBI)