CAS 1375474-44-4 appears in our catalog under these names: 3-Bromo-1-methyl-1H,6H,7H-pyrrolo(2,3-c)pyridin-7-one, 95%, 3-Bromo-1-methyl-1H,6H,7H-pyrrolo(2,3-c)pyridin-7-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-bromo-1-methyl-6H-pyrrolo[2,3-c]pyridin-7-one (CAS 1375474-44-4) is a chemical compound with the molecular formula C8H7BrN2O and a molecular weight of 227.06 g/mol. IUPAC name: 3-bromo-1-methyl-6H-pyrrolo[2,3-c]pyridin-7-one. InChIKey: VRXXFZNSNISYTJ-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O |
|---|---|
| Molecular weight | 227.06 g/mol |
| IUPAC name | 3-bromo-1-methyl-6H-pyrrolo[2,3-c]pyridin-7-one |
| InChIKey | VRXXFZNSNISYTJ-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=C1C(=O)NC=C2)Br |
Computed by PubChem (NCBI)