CAS 1375474-52-4 appears in our catalog under these names: 3-Methyl-N-(1,2,3,4-tetrahydroquinolin-6-yl)thiophene-2-carboxamide, 95%, 3-Methyl-N-(1,2,3,4-tetrahydroquinolin-6-yl)thiophene-2-carboxamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-methyl-N-(1,2,3,4-tetrahydroquinolin-6-yl)thiophene-2-carboxamide (CAS 1375474-52-4) is a chemical compound with the molecular formula C15H16N2OS and a molecular weight of 272.4 g/mol. IUPAC name: 3-methyl-N-(1,2,3,4-tetrahydroquinolin-6-yl)thiophene-2-carboxamide. InChIKey: PISHSIFMHAXKLA-UHFFFAOYSA-N.
| Molecular formula | C15H16N2OS |
|---|---|
| Molecular weight | 272.4 g/mol |
| IUPAC name | 3-methyl-N-(1,2,3,4-tetrahydroquinolin-6-yl)thiophene-2-carboxamide |
| InChIKey | PISHSIFMHAXKLA-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=C1)C(=O)NC2=CC3=C(C=C2)NCCC3 |
Computed by PubChem (NCBI)