CAS 13755-68-5 is the registry number for 5,5'-Thiobis(1-methyl-4-nitro-1H-Imidazole. Offered by: TRC. Available pack sizes: 1g.
1-methyl-5-(3-methyl-5-nitroimidazol-4-yl)sulfanyl-4-nitroimidazole (CAS 13755-68-5) is a chemical compound with the molecular formula C8H8N6O4S and a molecular weight of 284.25 g/mol. IUPAC name: 1-methyl-5-(3-methyl-5-nitroimidazol-4-yl)sulfanyl-4-nitroimidazole. InChIKey: CESYRHOMAKZIQW-UHFFFAOYSA-N.
| Molecular formula | C8H8N6O4S |
|---|---|
| Molecular weight | 284.25 g/mol |
| IUPAC name | 1-methyl-5-(3-methyl-5-nitroimidazol-4-yl)sulfanyl-4-nitroimidazole |
| InChIKey | CESYRHOMAKZIQW-UHFFFAOYSA-N |
| SMILES | CN1C=NC(=C1SC2=C(N=CN2C)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)