CAS 1375752-77-4 appears in our catalog under these names: (S,S)–BMS–984923, (S,S)-BMS-984923, 98%, 98%, (S,S)-BMS-984923, 98.82%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 5 mg.
(4S,5S)-5-(2-chlorophenyl)-4-[5-(2-phenylethynyl)-3-pyridinyl]-1,3-oxazolidin-2-one (CAS 1375752-77-4) is a chemical compound with the molecular formula C22H15ClN2O2 and a molecular weight of 374.8 g/mol. IUPAC name: (4S,5S)-5-(2-chlorophenyl)-4-[5-(2-phenylethynyl)-3-pyridinyl]-1,3-oxazolidin-2-one. InChIKey: IAYVUQJOKDFLAL-SFTDATJTSA-N.
| Molecular formula | C22H15ClN2O2 |
|---|---|
| Molecular weight | 374.8 g/mol |
| IUPAC name | (4S,5S)-5-(2-chlorophenyl)-4-[5-(2-phenylethynyl)-3-pyridinyl]-1,3-oxazolidin-2-one |
| InChIKey | IAYVUQJOKDFLAL-SFTDATJTSA-N |
| SMILES | C1=CC=C(C=C1)C#CC2=CC(=CN=C2)[C@H]3[C@@H](OC(=O)N3)C4=CC=CC=C4Cl |
Computed by PubChem (NCBI)