CAS 1375799-59-9 appears in our catalog under these names: Molidustat Sodium Salt, >95% (HPLC), Molidustat sodium salt, Molidustat (sodium). Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 1mg, 25mg, 5mg, 50mg, Get quote.
Sodium 1-(6-morpholin-4-ylpyrimidin-4-yl)-4-(triazol-1-yl)pyrazol-5-olate (CAS 1375799-59-9) is a chemical compound with the molecular formula C13H13N8NaO2 and a molecular weight of 336.28 g/mol. IUPAC name: sodium 1-(6-morpholin-4-ylpyrimidin-4-yl)-4-(triazol-1-yl)pyrazol-5-olate. InChIKey: VYRQLKYGGSWDNH-UHFFFAOYSA-M.
| Molecular formula | C13H13N8NaO2 |
|---|---|
| Molecular weight | 336.28 g/mol |
| IUPAC name | sodium 1-(6-morpholin-4-ylpyrimidin-4-yl)-4-(triazol-1-yl)pyrazol-5-olate |
| InChIKey | VYRQLKYGGSWDNH-UHFFFAOYSA-M |
| SMILES | C1COCCN1C2=NC=NC(=C2)N3C(=C(C=N3)N4C=CN=N4)[O-].[Na+] |
Computed by PubChem (NCBI)