CAS 1376574-47-8 is the registry number for p-Salicylic Acid 4-Glucuronide Potassium Salt, >95% (HPLC). Offered by: TRC. Available pack sizes: 50mg, 5mg.
Dipotassium;(2S,3S,4S,5R)-6-(4-carboxylatophenoxy)-3,4,5-trihydroxyoxane-2-carboxylate (CAS 1376574-47-8) is a chemical compound with the molecular formula C13H12K2O9 and a molecular weight of 390.42 g/mol. IUPAC name: dipotassium;(2S,3S,4S,5R)-6-(4-carboxylatophenoxy)-3,4,5-trihydroxyoxane-2-carboxylate. InChIKey: KPDYLOSOAFVPRB-PNVNMENNSA-L.
| Molecular formula | C13H12K2O9 |
|---|---|
| Molecular weight | 390.42 g/mol |
| IUPAC name | dipotassium;(2S,3S,4S,5R)-6-(4-carboxylatophenoxy)-3,4,5-trihydroxyoxane-2-carboxylate |
| InChIKey | KPDYLOSOAFVPRB-PNVNMENNSA-L |
| SMILES | C1=CC(=CC=C1C(=O)[O-])OC2[C@@H]([C@H]([C@@H]([C@H](O2)C(=O)[O-])O)O)O.[K+].[K+] |
Computed by PubChem (NCBI)