CAS 137687-00-4 appears in our catalog under these names: 4-Methylumbelliferyl a-D-glucosaminide, 4-Methylumbelliferyl a-D-glucosaminide, 5 mg, 4-Methylumbelliferyl a-D-glucosaminide, 10 mg, 4-Methylumbelliferyl a-D-glucosaminide, 25 mg, 4-Methylumbelliferyl a-D-glucosaminide, 50 mg. Offered by: Biosynth, Roth, Chemat Brand, TRC, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 100mg, on request, 100 mg, 25 mg.
7-[(2R,3R,4R,5S,6R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-methylchromen-2-one (CAS 137687-00-4) is a chemical compound with the molecular formula C16H19NO7 and a molecular weight of 337.32 g/mol. IUPAC name: 7-[(2R,3R,4R,5S,6R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-methylchromen-2-one. InChIKey: XPBYRVZLJCNXMD-BTAUDXDXSA-N.
| Molecular formula | C16H19NO7 |
|---|---|
| Molecular weight | 337.32 g/mol |
| IUPAC name | 7-[(2R,3R,4R,5S,6R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-methylchromen-2-one |
| InChIKey | XPBYRVZLJCNXMD-BTAUDXDXSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)N |
Computed by PubChem (NCBI)