CAS 13770-91-7 appears in our catalog under these names: Magnesium sulfamate hydrate, 99% , Sulfamic acid, magnesium salt (2:1), 99%,RG, 99%,RG. Offered by: Thermo Scientific (Alfa Aesar), Chemat. Available pack sizes: 250g, 1kg, 25g, 50g.
Magnesium disulfamate (CAS 13770-91-7) is a chemical compound with the molecular formula H4MgN2O6S2 and a molecular weight of 216.48 g/mol. IUPAC name: magnesium disulfamate. InChIKey: YZVJHCGMTYDKFR-UHFFFAOYSA-L.
| Molecular formula | H4MgN2O6S2 |
|---|---|
| Molecular weight | 216.48 g/mol |
| IUPAC name | magnesium disulfamate |
| InChIKey | YZVJHCGMTYDKFR-UHFFFAOYSA-L |
| SMILES | NS(=O)(=O)[O-].NS(=O)(=O)[O-].[Mg+2] |
Computed by PubChem (NCBI)