CAS 1377582-02-9 is the registry number for 2-Methoxy-5-(trifluoromethyl)phenylthiourea. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
[2-methoxy-5-(trifluoromethyl)phenyl]thiourea (CAS 1377582-02-9) is a chemical compound with the molecular formula C9H9F3N2OS and a molecular weight of 250.24 g/mol. IUPAC name: [2-methoxy-5-(trifluoromethyl)phenyl]thiourea. InChIKey: HKNBSBQMZIDUTD-UHFFFAOYSA-N.
| Molecular formula | C9H9F3N2OS |
|---|---|
| Molecular weight | 250.24 g/mol |
| IUPAC name | [2-methoxy-5-(trifluoromethyl)phenyl]thiourea |
| InChIKey | HKNBSBQMZIDUTD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(F)(F)F)NC(=S)N |
Computed by PubChem (NCBI)