CAS 137780-69-9 appears in our catalog under these names: Perfluoro-3,6-dioxadecanoic acid, 95%, Perfluoro-3,6-dioxadecanoicacid, 97%, Perfluoro-3,6-dioxadecanoic acid, 98%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 25g, 1g.
2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]acetic acid (CAS 137780-69-9) is a chemical compound with the molecular formula C8HF15O4 and a molecular weight of 446.07 g/mol. IUPAC name: 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]acetic acid. InChIKey: PPSAKBBLKCJDCR-UHFFFAOYSA-N.
| Molecular formula | C8HF15O4 |
|---|---|
| Molecular weight | 446.07 g/mol |
| IUPAC name | 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]acetic acid |
| InChIKey | PPSAKBBLKCJDCR-UHFFFAOYSA-N |
| SMILES | C(=O)(C(OC(C(OC(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)