CAS 13781-37-8 appears in our catalog under these names: 2-Iodo-5-phenylthiophene, 95%, 2–Iodo–5–phenylthiophene, 2-Iodo-5-phenylthiophene, >97.0%(GC), 2-Iodo-5-phenylthiophene 97%, 2-Iodo-5-phenylthiophene, 97%, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 10g, 5g, 25g.
2-iodo-5-phenylthiophene (CAS 13781-37-8) is a chemical compound with the molecular formula C10H7IS and a molecular weight of 286.13 g/mol. IUPAC name: 2-iodo-5-phenylthiophene. InChIKey: DHRIQSGKMRCNIU-UHFFFAOYSA-N.
| Molecular formula | C10H7IS |
|---|---|
| Molecular weight | 286.13 g/mol |
| IUPAC name | 2-iodo-5-phenylthiophene |
| InChIKey | DHRIQSGKMRCNIU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(S2)I |
Computed by PubChem (NCBI)