CAS 137836-88-5 is the registry number for 1,3-Diisopropyl-1H-imidazolium Hydroxide. Offered by: TRC. Available pack sizes: 1g.
1,3-di(propan-2-yl)imidazol-1-ium hydroxide (CAS 137836-88-5) is a chemical compound with the molecular formula C9H18N2O and a molecular weight of 170.25 g/mol. IUPAC name: 1,3-di(propan-2-yl)imidazol-1-ium hydroxide. InChIKey: HXGZXUVDQQOSAR-UHFFFAOYSA-M.
| Molecular formula | C9H18N2O |
|---|---|
| Molecular weight | 170.25 g/mol |
| IUPAC name | 1,3-di(propan-2-yl)imidazol-1-ium hydroxide |
| InChIKey | HXGZXUVDQQOSAR-UHFFFAOYSA-M |
| SMILES | CC(C)N1C=C[N+](=C1)C(C)C.[OH-] |
Computed by PubChem (NCBI)