Products 1378361-77-3

CAS 1378361-77-3 is the registry number for O-(4-Bromophenyl) ethanethioate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

O-(4-bromophenyl) ethanethioate (CAS 1378361-77-3) is a chemical compound with the molecular formula C8H7BrOS and a molecular weight of 231.11 g/mol. IUPAC name: O-(4-bromophenyl) ethanethioate. InChIKey: SKTGODZBBMAUPF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7BrOS
Molecular weight231.11 g/mol
IUPAC nameO-(4-bromophenyl) ethanethioate
InChIKeySKTGODZBBMAUPF-UHFFFAOYSA-N
SMILESCC(=S)OC1=CC=C(C=C1)Br

Computed by PubChem (NCBI)