CAS 1378387-81-5 appears in our catalog under these names: Ledipasvir Impurity 7, 7–Bromo–2–(chloroacetyl)–9,9–difluorofluorene, 7-Bromo-2-(chloroacetyl)-9,9-difluorofluorene, >98.0%(GC), 1-(7-Bromo-9,9-difluoro-9H-fluoren-2-yl)-2-chloroethanone 98+%, 1-(7-Bromo-9,9-difluoro-9H-fluoren-2-yl)-2-chloroethanone, 98%, 98%. Offered by: Hubei YoungXin, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 10g, 25g, 5g.
1-(7-bromo-9,9-difluorofluoren-2-yl)-2-chloroethanone (CAS 1378387-81-5) is a chemical compound with the molecular formula C15H8BrClF2O and a molecular weight of 357.57 g/mol. IUPAC name: 1-(7-bromo-9,9-difluorofluoren-2-yl)-2-chloroethanone. InChIKey: KHQZXVZXRCFXSC-UHFFFAOYSA-N.
| Molecular formula | C15H8BrClF2O |
|---|---|
| Molecular weight | 357.57 g/mol |
| IUPAC name | 1-(7-bromo-9,9-difluorofluoren-2-yl)-2-chloroethanone |
| InChIKey | KHQZXVZXRCFXSC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)CCl)C(C3=C2C=CC(=C3)Br)(F)F |
Computed by PubChem (NCBI)