Products 1378416-66-0
CAS 1378416-66-0 is the registry number for 5-(3,4-Dimethylphenyl)oxazole, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-(3,4-dimethylphenyl)-1,3-oxazole (CAS 1378416-66-0) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: 5-(3,4-dimethylphenyl)-1,3-oxazole. InChIKey: SBHWIRLFXUQIRQ-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 5-(3,4-dimethylphenyl)-1,3-oxazole |
| InChIKey | SBHWIRLFXUQIRQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=CN=CO2)C |
Computed by PubChem (NCBI)