CAS 1378466-04-6 is the registry number for 2-Amino-5-methoxy-4-nitrobenzyl alcohol. Offered by: Biosynth. Available pack sizes: 1000mg.
(2-amino-5-methoxy-4-nitrophenyl)methanol (CAS 1378466-04-6) is a chemical compound with the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. IUPAC name: (2-amino-5-methoxy-4-nitrophenyl)methanol. InChIKey: PPWCQYLWIMCVDY-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O4 |
|---|---|
| Molecular weight | 198.18 g/mol |
| IUPAC name | (2-amino-5-methoxy-4-nitrophenyl)methanol |
| InChIKey | PPWCQYLWIMCVDY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CO)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)