CAS 137862-57-8 appears in our catalog under these names: N-((2'-(2H-Tetrazol-5-yl)-[1,1'-biphenyl]-4-yl)methyl)-N-pentanoyl-L-alanine, 98%, Alanine Valsartan. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
(2S)-2-[pentanoyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]propanoic acid (CAS 137862-57-8) is a chemical compound with the molecular formula C22H25N5O3 and a molecular weight of 407.5 g/mol. IUPAC name: (2S)-2-[pentanoyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]propanoic acid. InChIKey: QFCDZSRVDUYPKU-HNNXBMFYSA-N.
| Molecular formula | C22H25N5O3 |
|---|---|
| Molecular weight | 407.5 g/mol |
| IUPAC name | (2S)-2-[pentanoyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]propanoic acid |
| InChIKey | QFCDZSRVDUYPKU-HNNXBMFYSA-N |
| SMILES | CCCCC(=O)N(CC1=CC=C(C=C1)C2=CC=CC=C2C3=NNN=N3)[C@@H](C)C(=O)O |
Computed by PubChem (NCBI)