Products 1378677-99-6

CAS 1378677-99-6 is the registry number for 2-Ethoxythiophene-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-ethoxythiophene-3-carboxylic acid (CAS 1378677-99-6) is a chemical compound with the molecular formula C7H8O3S and a molecular weight of 172.20 g/mol. IUPAC name: 2-ethoxythiophene-3-carboxylic acid. InChIKey: PIEZKBUYWDSLKG-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8O3S
Molecular weight172.20 g/mol
IUPAC name2-ethoxythiophene-3-carboxylic acid
InChIKeyPIEZKBUYWDSLKG-UHFFFAOYSA-N
SMILESCCOC1=C(C=CS1)C(=O)O

Computed by PubChem (NCBI)