CAS 1378683-82-9 is the registry number for 2,2-Difluoro-1-(2-fluorophenyl)ethan-1-one, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2,2-difluoro-1-(2-fluorophenyl)ethanone (CAS 1378683-82-9) is a chemical compound with the molecular formula C8H5F3O and a molecular weight of 174.12 g/mol. IUPAC name: 2,2-difluoro-1-(2-fluorophenyl)ethanone. InChIKey: ROMXIJKGAUMYOY-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O |
|---|---|
| Molecular weight | 174.12 g/mol |
| IUPAC name | 2,2-difluoro-1-(2-fluorophenyl)ethanone |
| InChIKey | ROMXIJKGAUMYOY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C(F)F)F |
Computed by PubChem (NCBI)