CAS 1378723-56-8 is the registry number for 6,7-Difluoro-1-(1-methanesulfonylpropan-2-yl)-1H-1,3-benzodiazol-2-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6,7-difluoro-1-(1-methylsulfonylpropan-2-yl)benzimidazol-2-amine (CAS 1378723-56-8) is a chemical compound with the molecular formula C11H13F2N3O2S and a molecular weight of 289.30 g/mol. IUPAC name: 6,7-difluoro-1-(1-methylsulfonylpropan-2-yl)benzimidazol-2-amine. InChIKey: CUOJHIYPZKXSPH-UHFFFAOYSA-N.
| Molecular formula | C11H13F2N3O2S |
|---|---|
| Molecular weight | 289.30 g/mol |
| IUPAC name | 6,7-difluoro-1-(1-methylsulfonylpropan-2-yl)benzimidazol-2-amine |
| InChIKey | CUOJHIYPZKXSPH-UHFFFAOYSA-N |
| SMILES | CC(CS(=O)(=O)C)N1C2=C(C=CC(=C2F)F)N=C1N |
Computed by PubChem (NCBI)