Products 1378830-70-6

CAS 1378830-70-6 is the registry number for 2-Hydroxy-4-methoxy-3,3-dimethylbutanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-hydroxy-4-methoxy-3,3-dimethylbutanoic acid (CAS 1378830-70-6) is a chemical compound with the molecular formula C7H14O4 and a molecular weight of 162.18 g/mol. IUPAC name: 2-hydroxy-4-methoxy-3,3-dimethylbutanoic acid. InChIKey: KAOALKAVGBEJIS-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14O4
Molecular weight162.18 g/mol
IUPAC name2-hydroxy-4-methoxy-3,3-dimethylbutanoic acid
InChIKeyKAOALKAVGBEJIS-UHFFFAOYSA-N
SMILESCC(C)(COC)C(C(=O)O)O

Computed by PubChem (NCBI)