CAS 1378849-61-6 appears in our catalog under these names: 6-Chloro-4H,7H-(1,2,4)triazolo(1,5-a)pyrimidin-7-one, 95%, 6-Chloro-4H,7H-(1,2,4)triazolo(1,5-a)pyrimidin-7-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
6-chloro-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (CAS 1378849-61-6) is a chemical compound with the molecular formula C5H3ClN4O and a molecular weight of 170.56 g/mol. IUPAC name: 6-chloro-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one. InChIKey: RTBFJLXECSQGAW-UHFFFAOYSA-N.
| Molecular formula | C5H3ClN4O |
|---|---|
| Molecular weight | 170.56 g/mol |
| IUPAC name | 6-chloro-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| InChIKey | RTBFJLXECSQGAW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)N2C(=N1)N=CN2)Cl |
Computed by PubChem (NCBI)