CAS 1378862-62-4 is the registry number for Ethyl 5-bromo-2,6-dichloropyrimidine-4-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 5-bromo-2,6-dichloropyrimidine-4-carboxylate (CAS 1378862-62-4) is a chemical compound with the molecular formula C7H5BrCl2N2O2 and a molecular weight of 299.93 g/mol. IUPAC name: ethyl 5-bromo-2,6-dichloropyrimidine-4-carboxylate. InChIKey: VZWVFBRZTJSIEH-UHFFFAOYSA-N.
| Molecular formula | C7H5BrCl2N2O2 |
|---|---|
| Molecular weight | 299.93 g/mol |
| IUPAC name | ethyl 5-bromo-2,6-dichloropyrimidine-4-carboxylate |
| InChIKey | VZWVFBRZTJSIEH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=NC(=N1)Cl)Cl)Br |
Computed by PubChem (NCBI)