Products 1378929-70-4
CAS 1378929-70-4 is the registry number for tert-Butyl 5-(trifluoroacetyl)-1,2,3,4-tetrahydropyridine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 5-(2,2,2-trifluoroacetyl)-3,4-dihydro-2H-pyridine-1-carboxylate (CAS 1378929-70-4) is a chemical compound with the molecular formula C12H16F3NO3 and a molecular weight of 279.26 g/mol. IUPAC name: tert-butyl 5-(2,2,2-trifluoroacetyl)-3,4-dihydro-2H-pyridine-1-carboxylate. InChIKey: TUGVELKCSKEUEA-UHFFFAOYSA-N.
| Molecular formula | C12H16F3NO3 |
|---|---|
| Molecular weight | 279.26 g/mol |
| IUPAC name | tert-butyl 5-(2,2,2-trifluoroacetyl)-3,4-dihydro-2H-pyridine-1-carboxylate |
| InChIKey | TUGVELKCSKEUEA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(=C1)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)