CAS 137897-99-5 appears in our catalog under these names: Disulfide, bis(3,5-dichlorophenyl), 99%, 99%, 1,2-Bis(3,5-dichlorophenyl)disulfane 99%, 1,2-Bis(3,5-dichlorophenyl)disulfane, 99%, Bis(3,5–dichlorophenyl) disulfide. Offered by: Chemat, Ambeed, Fluorochem, GLPBio. Available pack sizes: 250mg, 1g, 5g, 25g, 100g.
1,3-dichloro-5-[(3,5-dichlorophenyl)disulfanyl]benzene (CAS 137897-99-5) is a chemical compound with the molecular formula C12H6Cl4S2 and a molecular weight of 356.1 g/mol. IUPAC name: 1,3-dichloro-5-[(3,5-dichlorophenyl)disulfanyl]benzene. InChIKey: JMQANWHMOHXBEA-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl4S2 |
|---|---|
| Molecular weight | 356.1 g/mol |
| IUPAC name | 1,3-dichloro-5-[(3,5-dichlorophenyl)disulfanyl]benzene |
| InChIKey | JMQANWHMOHXBEA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)SSC2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)