CAS 1379006-71-9 is the registry number for 4-(1-(2,3-Dimethylphenyl)ethyl)-1-(triphenylmethyl)-1H-imidazole. Offered by: TRC. Available pack sizes: 100mg, 10mg, 1g.
4-[1-(2,3-dimethylphenyl)ethyl]-1-tritylimidazole (CAS 1379006-71-9) is a chemical compound with the molecular formula C32H30N2 and a molecular weight of 442.6 g/mol. IUPAC name: 4-[1-(2,3-dimethylphenyl)ethyl]-1-tritylimidazole. InChIKey: MGBBZIVEOAQPSD-UHFFFAOYSA-N.
| Molecular formula | C32H30N2 |
|---|---|
| Molecular weight | 442.6 g/mol |
| IUPAC name | 4-[1-(2,3-dimethylphenyl)ethyl]-1-tritylimidazole |
| InChIKey | MGBBZIVEOAQPSD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C(C)C2=CN(C=N2)C(C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5)C |
Computed by PubChem (NCBI)