CAS 1379169-99-9 is the registry number for 2-Iodo-5-nitropyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-iodo-5-nitropyrimidine (CAS 1379169-99-9) is a chemical compound with the molecular formula C4H2IN3O2 and a molecular weight of 250.98 g/mol. IUPAC name: 2-iodo-5-nitropyrimidine. InChIKey: QPYVTKNTCZDFQN-UHFFFAOYSA-N.
| Molecular formula | C4H2IN3O2 |
|---|---|
| Molecular weight | 250.98 g/mol |
| IUPAC name | 2-iodo-5-nitropyrimidine |
| InChIKey | QPYVTKNTCZDFQN-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=N1)I)[N+](=O)[O-] |
Computed by PubChem (NCBI)