Products 1379238-66-0
CAS 1379238-66-0 is the registry number for 6-Chloro-5-ethoxy-2,3-dihydro-1H-indole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-chloro-5-ethoxy-2,3-dihydro-1H-indole (CAS 1379238-66-0) is a chemical compound with the molecular formula C10H12ClNO and a molecular weight of 197.66 g/mol. IUPAC name: 6-chloro-5-ethoxy-2,3-dihydro-1H-indole. InChIKey: DHBDMFZRBMAUTM-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | 6-chloro-5-ethoxy-2,3-dihydro-1H-indole |
| InChIKey | DHBDMFZRBMAUTM-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C2C(=C1)CCN2)Cl |
Computed by PubChem (NCBI)