CAS 1379301-60-6 is the registry number for 3-Amino-6-bromo-1-benzofuran-2-carbonitrile. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
3-amino-6-bromo-1-benzofuran-2-carbonitrile (CAS 1379301-60-6) is a chemical compound with the molecular formula C9H5BrN2O and a molecular weight of 237.05 g/mol. IUPAC name: 3-amino-6-bromo-1-benzofuran-2-carbonitrile. InChIKey: UDEDNRWYHFARBO-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O |
|---|---|
| Molecular weight | 237.05 g/mol |
| IUPAC name | 3-amino-6-bromo-1-benzofuran-2-carbonitrile |
| InChIKey | UDEDNRWYHFARBO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)OC(=C2N)C#N |
Computed by PubChem (NCBI)