CAS 1379313-03-7 is the registry number for 4-Chloro-3-fluoro-α-methyl-α-(1-methylethyl)benzenemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(4-chloro-3-fluorophenyl)-3-methylbutan-2-ol (CAS 1379313-03-7) is a chemical compound with the molecular formula C11H14ClFO and a molecular weight of 216.68 g/mol. IUPAC name: 2-(4-chloro-3-fluorophenyl)-3-methylbutan-2-ol. InChIKey: CPMGMDSYWDWVAG-UHFFFAOYSA-N.
| Molecular formula | C11H14ClFO |
|---|---|
| Molecular weight | 216.68 g/mol |
| IUPAC name | 2-(4-chloro-3-fluorophenyl)-3-methylbutan-2-ol |
| InChIKey | CPMGMDSYWDWVAG-UHFFFAOYSA-N |
| SMILES | CC(C)C(C)(C1=CC(=C(C=C1)Cl)F)O |
Computed by PubChem (NCBI)