CAS 1379315-04-4 is the registry number for 4-Bromo-1-(trimethylsilyl)-1H-pyrrolo[2,3-b]pyridine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-bromopyrrolo[2,3-b]pyridin-1-yl)-trimethylsilane (CAS 1379315-04-4) is a chemical compound with the molecular formula C10H13BrN2Si and a molecular weight of 269.21 g/mol. IUPAC name: (4-bromopyrrolo[2,3-b]pyridin-1-yl)-trimethylsilane. InChIKey: KWITYDWDRPGAOG-UHFFFAOYSA-N.
| Molecular formula | C10H13BrN2Si |
|---|---|
| Molecular weight | 269.21 g/mol |
| IUPAC name | (4-bromopyrrolo[2,3-b]pyridin-1-yl)-trimethylsilane |
| InChIKey | KWITYDWDRPGAOG-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)N1C=CC2=C(C=CN=C21)Br |
Computed by PubChem (NCBI)