Products 1379315-59-9

CAS 1379315-59-9 appears in our catalog under these names: 3,3-Dimethyl-2-oxa-8-azaspiro[4.5]decane hydrochloride, 95%, 3,3-dimethyl-2-oxa-8-aza-spiro(4.5)decane hcl. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3,3-dimethyl-2-oxa-8-azaspiro[4.5]decane;hydrochloride (CAS 1379315-59-9) is a chemical compound with the molecular formula C10H20ClNO and a molecular weight of 205.72 g/mol. IUPAC name: 3,3-dimethyl-2-oxa-8-azaspiro[4.5]decane;hydrochloride. InChIKey: UPUSXTMLDUVFTP-UHFFFAOYSA-N.

Identity
Molecular formulaC10H20ClNO
Molecular weight205.72 g/mol
IUPAC name3,3-dimethyl-2-oxa-8-azaspiro[4.5]decane;hydrochloride
InChIKeyUPUSXTMLDUVFTP-UHFFFAOYSA-N
SMILESCC1(CC2(CCNCC2)CO1)C.Cl

Computed by PubChem (NCBI)