CAS 1379324-53-4 appears in our catalog under these names: 5–Bromo–2–(methylsulfonyl)pyrimidin–4–amine, 5-Bromo-2-(methylsulfonyl)pyrimidin-4-amine, 95%. Offered by: GLPBio, Combi-blocks, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
5-bromo-2-methylsulfonylpyrimidin-4-amine (CAS 1379324-53-4) is a chemical compound with the molecular formula C5H6BrN3O2S and a molecular weight of 252.09 g/mol. IUPAC name: 5-bromo-2-methylsulfonylpyrimidin-4-amine. InChIKey: QMDXZZOONBDILU-UHFFFAOYSA-N.
| Molecular formula | C5H6BrN3O2S |
|---|---|
| Molecular weight | 252.09 g/mol |
| IUPAC name | 5-bromo-2-methylsulfonylpyrimidin-4-amine |
| InChIKey | QMDXZZOONBDILU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=NC=C(C(=N1)N)Br |
Computed by PubChem (NCBI)