CAS 1379325-60-6 appears in our catalog under these names: 3-(Hydroxymethyl)oxetane-3-carboxylic acid, 95%, 3-(Hydroxymethyl)oxetane-3-carboxylic Acid, 90%, 3–(Hydroxymethyl)oxetane–3–carboxylic Acid, 3-(Hydroxymethyl)oxetane-3-carboxylic Acid, 97%, 97%, 3-(Hydroxymethyl)oxetane-3-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg.
Tert-butyl (3R)-3-(4-fluorophenoxy)pyrrolidine-1-carboxylate (CAS 1379325-60-6) is a chemical compound with the molecular formula C15H20FNO3 and a molecular weight of 281.32 g/mol. IUPAC name: tert-butyl (3R)-3-(4-fluorophenoxy)pyrrolidine-1-carboxylate. InChIKey: OCESHIJYWOFTKP-CYBMUJFWSA-N.
| Molecular formula | C15H20FNO3 |
|---|---|
| Molecular weight | 281.32 g/mol |
| IUPAC name | tert-butyl (3R)-3-(4-fluorophenoxy)pyrrolidine-1-carboxylate |
| InChIKey | OCESHIJYWOFTKP-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](C1)OC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)