CAS 1379327-75-9 is the registry number for 2-Bromo-4-fluoro-1H-1,3-benzodiazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-bromo-4-fluoro-1H-benzimidazole (CAS 1379327-75-9) is a chemical compound with the molecular formula C7H4BrFN2 and a molecular weight of 215.02 g/mol. IUPAC name: 2-bromo-4-fluoro-1H-benzimidazole. InChIKey: QVXVFVGOZGNHPM-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFN2 |
|---|---|
| Molecular weight | 215.02 g/mol |
| IUPAC name | 2-bromo-4-fluoro-1H-benzimidazole |
| InChIKey | QVXVFVGOZGNHPM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)N=C(N2)Br |
Computed by PubChem (NCBI)