Products 1379336-67-0

CAS 1379336-67-0 is the registry number for Methyl 3-amino-2-cycloheptylpropanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 3-amino-2-cycloheptylpropanoate (CAS 1379336-67-0) is a chemical compound with the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. IUPAC name: methyl 3-amino-2-cycloheptylpropanoate. InChIKey: RVWZYZQVGVNNIT-UHFFFAOYSA-N.

Identity
Molecular formulaC11H21NO2
Molecular weight199.29 g/mol
IUPAC namemethyl 3-amino-2-cycloheptylpropanoate
InChIKeyRVWZYZQVGVNNIT-UHFFFAOYSA-N
SMILESCOC(=O)C(CN)C1CCCCCC1

Computed by PubChem (NCBI)