CAS 1379347-14-4 appears in our catalog under these names: 5-(Bromomethyl)-4,6-dichloro-2-(methylsulfanyl)pyrimidine, 95%, 5-(Bromomethyl)-4,6-dichloro-2-(methylsulfanyl)pyrimidine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-(bromomethyl)-4,6-dichloro-2-methylsulfanylpyrimidine (CAS 1379347-14-4) is a chemical compound with the molecular formula C6H5BrCl2N2S and a molecular weight of 287.99 g/mol. IUPAC name: 5-(bromomethyl)-4,6-dichloro-2-methylsulfanylpyrimidine. InChIKey: SSSHTGHRDHAKJK-UHFFFAOYSA-N.
| Molecular formula | C6H5BrCl2N2S |
|---|---|
| Molecular weight | 287.99 g/mol |
| IUPAC name | 5-(bromomethyl)-4,6-dichloro-2-methylsulfanylpyrimidine |
| InChIKey | SSSHTGHRDHAKJK-UHFFFAOYSA-N |
| SMILES | CSC1=NC(=C(C(=N1)Cl)CBr)Cl |
Computed by PubChem (NCBI)