CAS 1379360-09-4 appears in our catalog under these names: 2-Methyl-2-((trimethylsilyl)oxy)propanamide, 95%, 2-Methyl-2-((trimethylsilyl)oxy)propanamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-methyl-2-trimethylsilyloxypropanamide (CAS 1379360-09-4) is a chemical compound with the molecular formula C7H17NO2Si and a molecular weight of 175.30 g/mol. IUPAC name: 2-methyl-2-trimethylsilyloxypropanamide. InChIKey: BFWNSWBWXXLDIW-UHFFFAOYSA-N.
| Molecular formula | C7H17NO2Si |
|---|---|
| Molecular weight | 175.30 g/mol |
| IUPAC name | 2-methyl-2-trimethylsilyloxypropanamide |
| InChIKey | BFWNSWBWXXLDIW-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)N)O[Si](C)(C)C |
Computed by PubChem (NCBI)