CAS 1379433-92-7 appears in our catalog under these names: 1-(2-Chloro-4-fluorophenyl)-2-nitropropene, 95%, 1-(2-Chloro-4-fluorophenyl)-2-nitropropene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 250mg, 50mg, 25mg.
2-chloro-4-fluoro-1-[(Z)-2-nitroprop-1-enyl]benzene (CAS 1379433-92-7) is a chemical compound with the molecular formula C9H7ClFNO2 and a molecular weight of 215.61 g/mol. IUPAC name: 2-chloro-4-fluoro-1-[(Z)-2-nitroprop-1-enyl]benzene. InChIKey: JOISMQUYUUEEAV-XQRVVYSFSA-N.
| Molecular formula | C9H7ClFNO2 |
|---|---|
| Molecular weight | 215.61 g/mol |
| IUPAC name | 2-chloro-4-fluoro-1-[(Z)-2-nitroprop-1-enyl]benzene |
| InChIKey | JOISMQUYUUEEAV-XQRVVYSFSA-N |
| SMILES | C/C(=C/C1=C(C=C(C=C1)F)Cl)/[N+](=O)[O-] |
Computed by PubChem (NCBI)