Products 1379481-94-3
CAS 1379481-94-3 is the registry number for Rel-(3aR,6aS)-tetrahydrofuro[3,4-d][1,3]dioxol-2-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3aR,6aS)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-2-one (CAS 1379481-94-3) is a chemical compound with the molecular formula C5H6O4 and a molecular weight of 130.10 g/mol. IUPAC name: (3aR,6aS)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-2-one. InChIKey: WTXSGZSEDKDSHR-ZXZARUISSA-N.
| Molecular formula | C5H6O4 |
|---|---|
| Molecular weight | 130.10 g/mol |
| IUPAC name | (3aR,6aS)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-2-one |
| InChIKey | WTXSGZSEDKDSHR-ZXZARUISSA-N |
| SMILES | C1[C@@H]2[C@H](CO1)OC(=O)O2 |
Computed by PubChem (NCBI)