CAS 1379518-17-8 is the registry number for tert-Butyl 7-bromo-9-fluoro-2,3-dihydrobenzo[f][1,4]oxazepine-4(5H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 7-bromo-9-fluoro-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate (CAS 1379518-17-8) is a chemical compound with the molecular formula C14H17BrFNO3 and a molecular weight of 346.19 g/mol. IUPAC name: tert-butyl 7-bromo-9-fluoro-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate. InChIKey: KQBIVPLFNVGSJA-UHFFFAOYSA-N.
| Molecular formula | C14H17BrFNO3 |
|---|---|
| Molecular weight | 346.19 g/mol |
| IUPAC name | tert-butyl 7-bromo-9-fluoro-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate |
| InChIKey | KQBIVPLFNVGSJA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOC2=C(C1)C=C(C=C2F)Br |
Computed by PubChem (NCBI)