CAS 1379546-88-9 is the registry number for (S)-3-Boc-4-(3-bromophenyl)-1,2,3-oxathiazolidine 2,2-dioxide, 95%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
Tert-butyl (4S)-4-(3-bromophenyl)-2,2-dioxooxathiazolidine-3-carboxylate (CAS 1379546-88-9) is a chemical compound with the molecular formula C13H16BrNO5S and a molecular weight of 378.24 g/mol. IUPAC name: tert-butyl (4S)-4-(3-bromophenyl)-2,2-dioxooxathiazolidine-3-carboxylate. InChIKey: UYKAZOPSUMUFGS-LLVKDONJSA-N.
| Molecular formula | C13H16BrNO5S |
|---|---|
| Molecular weight | 378.24 g/mol |
| IUPAC name | tert-butyl (4S)-4-(3-bromophenyl)-2,2-dioxooxathiazolidine-3-carboxylate |
| InChIKey | UYKAZOPSUMUFGS-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H](COS1(=O)=O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)