CAS 1379583-33-1 is the registry number for Petromyzonol 24-Sulfate Sodium Salt. Offered by: TRC. Available pack sizes: 10mg, 1mg.
CAS 1379583-33-1 identifies a chemical compound with the molecular formula C24H42NaO7S and a molecular weight of 497.6 g/mol. InChIKey: ZYRMDOXTNMDVGP-HSJYDADISA-N.
| Molecular formula | C24H42NaO7S |
|---|---|
| Molecular weight | 497.6 g/mol |
| InChIKey | ZYRMDOXTNMDVGP-HSJYDADISA-N |
| SMILES | C[C@H](CCCOS(=O)(=O)O)[C@H]1CC[C@@H]2[C@@]1([C@H](C[C@H]3[C@H]2[C@@H](C[C@@H]4[C@@]3(CC[C@H](C4)O)C)O)O)C.[Na] |
Computed by PubChem (NCBI)