CAS 1379612-59-5 is the registry number for 7,7'-Diphenyl-7H,7'H-10,10'-bibenzo[c]carbazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
7-phenyl-10-(7-phenylbenzo[c]carbazol-10-yl)benzo[c]carbazole (CAS 1379612-59-5) is a chemical compound with the molecular formula C44H28N2 and a molecular weight of 584.7 g/mol. IUPAC name: 7-phenyl-10-(7-phenylbenzo[c]carbazol-10-yl)benzo[c]carbazole. InChIKey: ZEQONRDJKVROED-UHFFFAOYSA-N.
| Molecular formula | C44H28N2 |
|---|---|
| Molecular weight | 584.7 g/mol |
| IUPAC name | 7-phenyl-10-(7-phenylbenzo[c]carbazol-10-yl)benzo[c]carbazole |
| InChIKey | ZEQONRDJKVROED-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=C(C=C(C=C3)C4=CC5=C(C=C4)N(C6=C5C7=CC=CC=C7C=C6)C8=CC=CC=C8)C9=C2C=CC1=CC=CC=C19 |
Computed by PubChem (NCBI)