CAS 1379686-30-2 appears in our catalog under these names: SR9009, 97%, SR 9009, >95% (HPLC), SR9009/ 99.53% (existing batch purity), SR9009, REV-ERB Agonist II, SR9009 1PC X 25MG. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 10mg, 25mg, 5mg, 1mg, 2mg, 50mg.
Ethyl 3-[[(4-chlorophenyl)methyl-[(5-nitrothiophen-2-yl)methyl]amino]methyl]pyrrolidine-1-carboxylate (CAS 1379686-30-2) is a chemical compound with the molecular formula C20H24ClN3O4S and a molecular weight of 437.9 g/mol. IUPAC name: ethyl 3-[[(4-chlorophenyl)methyl-[(5-nitrothiophen-2-yl)methyl]amino]methyl]pyrrolidine-1-carboxylate. InChIKey: MMJJNHOIVCGAAP-UHFFFAOYSA-N.
| Molecular formula | C20H24ClN3O4S |
|---|---|
| Molecular weight | 437.9 g/mol |
| IUPAC name | ethyl 3-[[(4-chlorophenyl)methyl-[(5-nitrothiophen-2-yl)methyl]amino]methyl]pyrrolidine-1-carboxylate |
| InChIKey | MMJJNHOIVCGAAP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1CCC(C1)CN(CC2=CC=C(C=C2)Cl)CC3=CC=C(S3)[N+](=O)[O-] |
Computed by PubChem (NCBI)