CAS 137977-35-6 is the registry number for Tolvaptan Impurity 43. Offered by: Chemat Brand. Available pack sizes: on request.
N-[4-(7-chloro-5-oxo-3,4-dihydro-2H-1-benzazepine-1-carbonyl)phenyl]-2-methylbenzamide (CAS 137977-35-6) is a chemical compound with the molecular formula C25H21ClN2O3 and a molecular weight of 432.9 g/mol. IUPAC name: N-[4-(7-chloro-5-oxo-3,4-dihydro-2H-1-benzazepine-1-carbonyl)phenyl]-2-methylbenzamide. InChIKey: ZGZSAFWXIFBPKI-UHFFFAOYSA-N.
| Molecular formula | C25H21ClN2O3 |
|---|---|
| Molecular weight | 432.9 g/mol |
| IUPAC name | N-[4-(7-chloro-5-oxo-3,4-dihydro-2H-1-benzazepine-1-carbonyl)phenyl]-2-methylbenzamide |
| InChIKey | ZGZSAFWXIFBPKI-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C(=O)NC2=CC=C(C=C2)C(=O)N3CCCC(=O)C4=C3C=CC(=C4)Cl |
Computed by PubChem (NCBI)