Products 1379794-41-8

CAS 1379794-41-8 appears in our catalog under these names: 5-(Difluoromethoxy)-1-methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic Acid, >95% (HPLC), Pyroxasulfone metabolite 3, Pyroxasulfone Metabolite 3, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 100mg, 10mg, 25mg, 1x1ml.

Structural formula: {0} (CAS {1})

5-(difluoromethoxy)-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylic acid (CAS 1379794-41-8) is a chemical compound with the molecular formula C7H5F5N2O3 and a molecular weight of 260.12 g/mol. IUPAC name: 5-(difluoromethoxy)-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylic acid. InChIKey: MYUDLFRMVZXUQY-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5F5N2O3
Molecular weight260.12 g/mol
IUPAC name5-(difluoromethoxy)-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylic acid
InChIKeyMYUDLFRMVZXUQY-UHFFFAOYSA-N
SMILESCN1C(=C(C(=N1)C(F)(F)F)C(=O)O)OC(F)F

Computed by PubChem (NCBI)