CAS 1379811-56-9 is the registry number for N-(4-Methyl-3-nitrophenyl)imidodicarbonimidic diamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(diaminomethylidene)-2-(4-methyl-3-nitrophenyl)guanidine (CAS 1379811-56-9) is a chemical compound with the molecular formula C9H12N6O2 and a molecular weight of 236.23 g/mol. IUPAC name: 1-(diaminomethylidene)-2-(4-methyl-3-nitrophenyl)guanidine. InChIKey: LZUVDCBBUFSLHY-UHFFFAOYSA-N.
| Molecular formula | C9H12N6O2 |
|---|---|
| Molecular weight | 236.23 g/mol |
| IUPAC name | 1-(diaminomethylidene)-2-(4-methyl-3-nitrophenyl)guanidine |
| InChIKey | LZUVDCBBUFSLHY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N=C(N)N=C(N)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)